About furo[3,4-c]pyridin-1-ol
furo[3,4-c]pyridin-1-ol (PubChem CID 67873695) has the molecular formula C7H5NO2
and a molecular weight of 135.12 g/mol. Its IUPAC name is furo[3,4-c]pyridin-1-ol.
Molecular Properties
| Compound Name | furo[3,4-c]pyridin-1-ol |
| PubChem CID | 67873695 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | furo[3,4-c]pyridin-1-ol |
| SMILES | Oc1occ2cnccc12 |
| InChI | InChI=1S/C7H5NO2/c9-7-6-1-2-8-3-5(6)4-10-7/h1-4,9H |
| InChIKey | YVECRCZZSGAGOW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[3,4-c]pyridin-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,4-c]pyridin-1-ol?
The IUPAC name of furo[3,4-c]pyridin-1-ol (CID 67873695) is furo[3,4-c]pyridin-1-ol.
What is the SMILES notation for furo[3,4-c]pyridin-1-ol?
The canonical SMILES for furo[3,4-c]pyridin-1-ol is Oc1occ2cnccc12.
What is the InChIKey of furo[3,4-c]pyridin-1-ol?
The InChIKey is YVECRCZZSGAGOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2/c9-7-6-1-2-8-3-5(6)4-10-7/h1-4,9H.
What are the key properties of furo[3,4-c]pyridin-1-ol?
furo[3,4-c]pyridin-1-ol has a molecular weight of 135.12 g/mol, XLogP of 1.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,4-c]pyridin-1-ol is sourced from PubChem (CID 67873695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).