C16H27BrN2O2Si — CID 140746327
3-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethylcyclobutan-1-ol (PubChem CID 140746327) has the molecular formula C16H27BrN2O2Si and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethylcyclobutan-1-ol.
| Compound Name | 3-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 140746327 |
| Molecular Formula | C16H27BrN2O2Si |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-(5-bromopyrimidin-2-yl)-3-[tert-butyl(dimethyl)silyl]oxy-1-ethylcyclobutan-1-ol |
| SMILES | CCC1(O)CC(O[Si](C)(C)C(C)(C)C)(c2ncc(Br)cn2)C1 |
| InChI | InChI=1S/C16H27BrN2O2Si/c1-7-15(20)10-16(11-15,13-18-8-12(17)9-19-13)21-22(5,6)14(2,3)4/h8-9,20H,7,10-11H2,1-6H3 |
| InChIKey | CILSBURSBRWPLE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|