C16H25BrF2N2O2Si — CID 178039176
1-[2-(5-bromopyrimidin-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoroethyl]cyclobutan-1-ol (PubChem CID 178039176) has the molecular formula C16H25BrF2N2O2Si and a molecular weight of 423.37 g/mol. Its IUPAC name is 1-[2-(5-bromopyrimidin-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoroethyl]cyclobutan-1-ol.
| Compound Name | 1-[2-(5-bromopyrimidin-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoroethyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 178039176 |
| Molecular Formula | C16H25BrF2N2O2Si |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-[2-(5-bromopyrimidin-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-1,1-difluoroethyl]cyclobutan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC(c1ncc(Br)cn1)C(F)(F)C1(O)CCC1 |
| InChI | InChI=1S/C16H25BrF2N2O2Si/c1-14(2,3)24(4,5)23-12(13-20-9-11(17)10-21-13)16(18,19)15(22)7-6-8-15/h9-10,12,22H,6-8H2,1-5H3 |
| InChIKey | AWIGMKXTRKSAQK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|