C18H22BrF2NOSi — CID 174313006
[(5-bromo-2-pyridinyl)-(2,4-difluorophenyl)methoxy]-tert-butyl-dimethylsilane (PubChem CID 174313006) has the molecular formula C18H22BrF2NOSi and a molecular weight of 414.37 g/mol. Its IUPAC name is [(5-bromo-2-pyridinyl)-(2,4-difluorophenyl)methoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(5-bromo-2-pyridinyl)-(2,4-difluorophenyl)methoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174313006 |
| Molecular Formula | C18H22BrF2NOSi |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | [(5-bromo-2-pyridinyl)-(2,4-difluorophenyl)methoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(c1ccc(Br)cn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H22BrF2NOSi/c1-18(2,3)24(4,5)23-17(16-9-6-12(19)11-22-16)14-8-7-13(20)10-15(14)21/h6-11,17H,1-5H3 |
| InChIKey | YNXIYZSNRLZDMO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|