C15H25BrFNO3SSi — CID 140771365
(1R,2R)-1-(4-bromo-2-fluorophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropane-2-sulfonamide (PubChem CID 140771365) has the molecular formula C15H25BrFNO3SSi and a molecular weight of 426.42 g/mol. Its IUPAC name is (1R,2R)-1-(4-bromo-2-fluorophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropane-2-sulfonamide.
| Compound Name | (1R,2R)-1-(4-bromo-2-fluorophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropane-2-sulfonamide |
|---|---|
| PubChem CID | 140771365 |
| Molecular Formula | C15H25BrFNO3SSi |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | (1R,2R)-1-(4-bromo-2-fluorophenyl)-1-[tert-butyl(dimethyl)silyl]oxypropane-2-sulfonamide |
| SMILES | C[C@H]([C@H](O[Si](C)(C)C(C)(C)C)c1ccc(Br)cc1F)S(N)(=O)=O |
| InChI | InChI=1S/C15H25BrFNO3SSi/c1-10(22(18,19)20)14(21-23(5,6)15(2,3)4)12-8-7-11(16)9-13(12)17/h7-10,14H,1-6H3,(H2,18,19,20)/t10-,14+/m1/s1 |
| InChIKey | JASHMVZWZMGKTF-YGRLFVJLSA-N |
| XLogP | 4.33 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|