C10H13BrFNO2S — CID 114905996
1-(4-bromo-2-fluorophenyl)-3-methylsulfonylpropan-1-amine (PubChem CID 114905996) has the molecular formula C10H13BrFNO2S and a molecular weight of 310.19 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-methylsulfonylpropan-1-amine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 114905996 |
| Molecular Formula | C10H13BrFNO2S |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-methylsulfonylpropan-1-amine |
| SMILES | CS(=O)(=O)CCC(N)c1ccc(Br)cc1F |
| InChI | InChI=1S/C10H13BrFNO2S/c1-16(14,15)5-4-10(13)8-3-2-7(11)6-9(8)12/h2-3,6,10H,4-5,13H2,1H3 |
| InChIKey | IOVIKFCWHACZAH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |