C12H17F2NO2S — CID 115820220
1-(2,4-difluoro-5-methylphenyl)-4-methylsulfonylbutan-1-amine (PubChem CID 115820220) has the molecular formula C12H17F2NO2S and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-4-methylsulfonylbutan-1-amine.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-4-methylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 115820220 |
| Molecular Formula | C12H17F2NO2S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-4-methylsulfonylbutan-1-amine |
| SMILES | Cc1cc(C(N)CCCS(C)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C12H17F2NO2S/c1-8-6-9(11(14)7-10(8)13)12(15)4-3-5-18(2,16)17/h6-7,12H,3-5,15H2,1-2H3 |
| InChIKey | YCCYNMJZKPGEGV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |