C12H17F2N — CID 79724390
1-(2,4-difluoro-5-methylphenyl)-3-methylbutan-1-amine (PubChem CID 79724390) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-3-methylbutan-1-amine.
| Compound Name | 1-(2,4-difluoro-5-methylphenyl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 79724390 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-(2,4-difluoro-5-methylphenyl)-3-methylbutan-1-amine |
| SMILES | Cc1cc(C(N)CC(C)C)c(F)cc1F |
| InChI | InChI=1S/C12H17F2N/c1-7(2)4-12(15)9-5-8(3)10(13)6-11(9)14/h5-7,12H,4,15H2,1-3H3 |
| InChIKey | JOODTSNMQQVKRJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |