C15H13Cl2F2N — CID 115830073
2-(2,6-dichlorophenyl)-1-(2,4-difluoro-5-methylphenyl)ethanamine (PubChem CID 115830073) has the molecular formula C15H13Cl2F2N and a molecular weight of 316.18 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(2,4-difluoro-5-methylphenyl)ethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(2,4-difluoro-5-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 115830073 |
| Molecular Formula | C15H13Cl2F2N |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(2,4-difluoro-5-methylphenyl)ethanamine |
| SMILES | Cc1cc(C(N)Cc2c(Cl)cccc2Cl)c(F)cc1F |
| InChI | InChI=1S/C15H13Cl2F2N/c1-8-5-10(14(19)7-13(8)18)15(20)6-9-11(16)3-2-4-12(9)17/h2-5,7,15H,6,20H2,1H3 |
| InChIKey | JSSDKTQYUHAMAB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |