C17H19BrFN — CID 114906230
1-(4-bromo-2-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanamine (PubChem CID 114906230) has the molecular formula C17H19BrFN and a molecular weight of 336.25 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanamine.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 114906230 |
| Molecular Formula | C17H19BrFN |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanamine |
| SMILES | Cc1cc(C)c(CC(N)c2ccc(Br)cc2F)c(C)c1 |
| InChI | InChI=1S/C17H19BrFN/c1-10-6-11(2)15(12(3)7-10)9-17(20)14-5-4-13(18)8-16(14)19/h4-8,17H,9,20H2,1-3H3 |
| InChIKey | CQQSMRHQBJBTOO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |