C20H30N2O3SSi — CID 11143971
(E)-3-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-enenitrile (PubChem CID 11143971) has the molecular formula C20H30N2O3SSi and a molecular weight of 406.62 g/mol. Its IUPAC name is (E)-3-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 11143971 |
| Molecular Formula | C20H30N2O3SSi |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (E)-3-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]prop-2-enenitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]2/C=C/C#N)cc1 |
| InChI | InChI=1S/C20H30N2O3SSi/c1-16-9-11-19(12-10-16)26(23,24)22-15-18(14-17(22)8-7-13-21)25-27(5,6)20(2,3)4/h7-12,17-18H,14-15H2,1-6H3/b8-7+/t17-,18-/m1/s1 |
| InChIKey | CVHGVYAVPSIWJQ-HNGSOEQISA-N |
| XLogP | 4.23 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|