C26H45NO3SSi2 — CID 100970654
tert-butyl-dimethyl-[(E,2S)-1-[(6S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-6-yl]-5-trimethylsilylpent-3-en-2-yl]oxysilane (PubChem CID 100970654) has the molecular formula C26H45NO3SSi2 and a molecular weight of 507.89 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,2S)-1-[(6S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-6-yl]-5-trimethylsilylpent-3-en-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,2S)-1-[(6S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-6-yl]-5-trimethylsilylpent-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 100970654 |
| Molecular Formula | C26H45NO3SSi2 |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | tert-butyl-dimethyl-[(E,2S)-1-[(6S)-1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-6-yl]-5-trimethylsilylpent-3-en-2-yl]oxysilane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC=C[C@@H]2C[C@@H](/C=C/C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H45NO3SSi2/c1-22-15-17-25(18-16-22)31(28,29)27-19-11-10-13-23(27)21-24(14-12-20-32(5,6)7)30-33(8,9)26(2,3)4/h10,12-18,23-24H,11,19-21H2,1-9H3/b14-12+/t23-,24-/m1/s1 |
| InChIKey | CMOCFBXNPVKPDN-DVZRSZBPSA-N |
| XLogP | 6.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|