C25H41NO5SSi — CID 46703566
tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate (PubChem CID 46703566) has the molecular formula C25H41NO5SSi and a molecular weight of 495.76 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate |
|---|---|
| PubChem CID | 46703566 |
| Molecular Formula | C25H41NO5SSi |
| Molecular Weight | 495.76 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | tert-butyl (2S)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C(C(=O)OC(C)(C)C)[C@@H]2CCCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H41NO5SSi/c1-19-12-14-20(15-13-19)32(28,29)26-17-16-21(23(27)31-24(2,3)4)22(26)11-10-18-30-33(8,9)25(5,6)7/h12-16,22H,10-11,17-18H2,1-9H3/t22-/m0/s1 |
| InChIKey | PPSWUSXVUFOHKF-QFIPXVFZSA-N |
| XLogP | 5.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.76 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|