C24H30O5S — CID 166561028
tert-butyl 2-[2-[3-(4-methylphenyl)sulfonyloxypropyl]cyclopropyl]benzoate (PubChem CID 166561028) has the molecular formula C24H30O5S and a molecular weight of 430.57 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-(4-methylphenyl)sulfonyloxypropyl]cyclopropyl]benzoate.
| Compound Name | tert-butyl 2-[2-[3-(4-methylphenyl)sulfonyloxypropyl]cyclopropyl]benzoate |
|---|---|
| PubChem CID | 166561028 |
| Molecular Formula | C24H30O5S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | tert-butyl 2-[2-[3-(4-methylphenyl)sulfonyloxypropyl]cyclopropyl]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCC2CC2c2ccccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H30O5S/c1-17-11-13-19(14-12-17)30(26,27)28-15-7-8-18-16-22(18)20-9-5-6-10-21(20)23(25)29-24(2,3)4/h5-6,9-14,18,22H,7-8,15-16H2,1-4H3 |
| InChIKey | WXJVPPLWOWWCPW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|