C23H29FO5S — CID 166524823
tert-butyl 5-fluoro-2-[5-(4-methylphenyl)sulfonyloxypentyl]benzoate (PubChem CID 166524823) has the molecular formula C23H29FO5S and a molecular weight of 436.55 g/mol. Its IUPAC name is tert-butyl 5-fluoro-2-[5-(4-methylphenyl)sulfonyloxypentyl]benzoate.
| Compound Name | tert-butyl 5-fluoro-2-[5-(4-methylphenyl)sulfonyloxypentyl]benzoate |
|---|---|
| PubChem CID | 166524823 |
| Molecular Formula | C23H29FO5S |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | tert-butyl 5-fluoro-2-[5-(4-methylphenyl)sulfonyloxypentyl]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCc2ccc(F)cc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29FO5S/c1-17-9-13-20(14-10-17)30(26,27)28-15-7-5-6-8-18-11-12-19(24)16-21(18)22(25)29-23(2,3)4/h9-14,16H,5-8,15H2,1-4H3 |
| InChIKey | IPVNSDVZRXKUMW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|