C23H22FNO4S — CID 122634590
3-[4-carbamoyl-2-(4-fluorophenyl)phenyl]propyl 4-methylbenzenesulfonate (PubChem CID 122634590) has the molecular formula C23H22FNO4S and a molecular weight of 427.50 g/mol. Its IUPAC name is 3-[4-carbamoyl-2-(4-fluorophenyl)phenyl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[4-carbamoyl-2-(4-fluorophenyl)phenyl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 122634590 |
| Molecular Formula | C23H22FNO4S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 3-[4-carbamoyl-2-(4-fluorophenyl)phenyl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCc2ccc(C(N)=O)cc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H22FNO4S/c1-16-4-12-21(13-5-16)30(27,28)29-14-2-3-17-6-7-19(23(25)26)15-22(17)18-8-10-20(24)11-9-18/h4-13,15H,2-3,14H2,1H3,(H2,25,26) |
| InChIKey | NIPHVVBRKSVOIW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|