C26H41NO3SSi — CID 101197765
tert-butyl-[(E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-2-enoxy]-dimethylsilane (PubChem CID 101197765) has the molecular formula C26H41NO3SSi and a molecular weight of 475.77 g/mol. Its IUPAC name is tert-butyl-[(E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101197765 |
| Molecular Formula | C26H41NO3SSi |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | tert-butyl-[(E)-7-[4-ethenyl-1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrol-2-yl]hept-2-enoxy]-dimethylsilane |
| SMILES | C=CC1=CC(CCCC/C=C/CO[Si](C)(C)C(C)(C)C)N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C26H41NO3SSi/c1-8-23-20-24(27(21-23)31(28,29)25-17-15-22(2)16-18-25)14-12-10-9-11-13-19-30-32(6,7)26(3,4)5/h8,11,13,15-18,20,24H,1,9-10,12,14,19,21H2,2-7H3/b13-11+ |
| InChIKey | PDLIUWSXIZZDAY-ACCUITESSA-N |
| XLogP | 6.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|