C28H37NO6SSi — CID 57412658
(3S,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,7a-hexahydroindol-5-ol (PubChem CID 57412658) has the molecular formula C28H37NO6SSi and a molecular weight of 543.76 g/mol. Its IUPAC name is (3S,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,7a-hexahydroindol-5-ol.
| Compound Name | (3S,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,7a-hexahydroindol-5-ol |
|---|---|
| PubChem CID | 57412658 |
| Molecular Formula | C28H37NO6SSi |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | (3S,5R,6S,7aR)-3-(1,3-benzodioxol-5-yl)-6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfonyl-2,3,5,6,7,7a-hexahydroindol-5-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](c3ccc4c(c3)OCO4)C3=C[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]32)cc1 |
| InChI | InChI=1S/C28H37NO6SSi/c1-18-7-10-20(11-8-18)36(31,32)29-16-22(19-9-12-25-27(13-19)34-17-33-25)21-14-24(30)26(15-23(21)29)35-37(5,6)28(2,3)4/h7-14,22-24,26,30H,15-17H2,1-6H3/t22-,23+,24+,26-/m0/s1 |
| InChIKey | QZFIUHGUYNAHSB-WSKLTFMVSA-N |
| XLogP | 4.96 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|