C22H23NO5S — CID 10645410
(3R,3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-ol (PubChem CID 10645410) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is (3R,3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-ol.
| Compound Name | (3R,3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-ol |
|---|---|
| PubChem CID | 10645410 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (3R,3aS,7aS)-3a-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](O)[C@]3(c4ccc5c(c4)OCO5)C=CCC[C@H]23)cc1 |
| InChI | InChI=1S/C22H23NO5S/c1-15-5-8-17(9-6-15)29(25,26)23-13-21(24)22(11-3-2-4-20(22)23)16-7-10-18-19(12-16)28-14-27-18/h3,5-12,20-21,24H,2,4,13-14H2,1H3/t20-,21-,22-/m0/s1 |
| InChIKey | YOQQOHYIBPARLU-FKBYEOEOSA-N |
| XLogP | 2.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|