C23H27N3O6S — CID 42884742
N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide (PubChem CID 42884742) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide.
| Compound Name | N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 42884742 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N'-[3-(1,3-benzodioxol-5-yl)propanoyl]-1-(4-methylphenyl)sulfonylpiperidine-3-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NNC(=O)CCc3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C23H27N3O6S/c1-16-4-8-19(9-5-16)33(29,30)26-12-2-3-18(14-26)23(28)25-24-22(27)11-7-17-6-10-20-21(13-17)32-15-31-20/h4-6,8-10,13,18H,2-3,7,11-12,14-15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | LDKVEJKPDDFDSM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|