C24H29NO5S — CID 10694561
[(3R,3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-yl]methanol (PubChem CID 10694561) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is [(3R,3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-yl]methanol.
| Compound Name | [(3R,3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-yl]methanol |
|---|---|
| PubChem CID | 10694561 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [(3R,3aS,7aS)-3a-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-3,6,7,7a-tetrahydro-2H-indol-3-yl]methanol |
| SMILES | COc1ccc([C@@]23C=CCC[C@@H]2N(S(=O)(=O)c2ccc(C)cc2)C[C@@H]3CO)cc1OC |
| InChI | InChI=1S/C24H29NO5S/c1-17-7-10-20(11-8-17)31(27,28)25-15-19(16-26)24(13-5-4-6-23(24)25)18-9-12-21(29-2)22(14-18)30-3/h5,7-14,19,23,26H,4,6,15-16H2,1-3H3/t19-,23+,24-/m1/s1 |
| InChIKey | SEQDSNVGRZBVTC-VEXUSMLFSA-N |
| XLogP | 3.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|