C29H39NO7S — CID 22210310
[(3'S)-3'-(3,4-dimethoxyphenyl)-5,5-dimethyl-1'-(4-methylphenyl)sulfonylspiro[1,3-dioxane-2,6'-3,3a,4,5,7,7a-hexahydro-2H-indole]-7'-yl]methanol (PubChem CID 22210310) has the molecular formula C29H39NO7S and a molecular weight of 545.70 g/mol. Its IUPAC name is [(3'S)-3'-(3,4-dimethoxyphenyl)-5,5-dimethyl-1'-(4-methylphenyl)sulfonylspiro[1,3-dioxane-2,6'-3,3a,4,5,7,7a-hexahydro-2H-indole]-7'-yl]methanol.
| Compound Name | [(3'S)-3'-(3,4-dimethoxyphenyl)-5,5-dimethyl-1'-(4-methylphenyl)sulfonylspiro[1,3-dioxane-2,6'-3,3a,4,5,7,7a-hexahydro-2H-indole]-7'-yl]methanol |
|---|---|
| PubChem CID | 22210310 |
| Molecular Formula | C29H39NO7S |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | [(3'S)-3'-(3,4-dimethoxyphenyl)-5,5-dimethyl-1'-(4-methylphenyl)sulfonylspiro[1,3-dioxane-2,6'-3,3a,4,5,7,7a-hexahydro-2H-indole]-7'-yl]methanol |
| SMILES | COc1ccc([C@H]2CN(S(=O)(=O)c3ccc(C)cc3)C3C2CCC2(OCC(C)(C)CO2)C3CO)cc1OC |
| InChI | InChI=1S/C29H39NO7S/c1-19-6-9-21(10-7-19)38(32,33)30-15-23(20-8-11-25(34-4)26(14-20)35-5)22-12-13-29(24(16-31)27(22)30)36-17-28(2,3)18-37-29/h6-11,14,22-24,27,31H,12-13,15-18H2,1-5H3/t22?,23-,24?,27?/m1/s1 |
| InChIKey | SGYYAIJDBKVHCP-KACNVIOASA-N |
| XLogP | 3.96 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |