C19H22ClNO4S — CID 110369532
4-(3-chloro-4-methoxyphenyl)sulfonyl-5-methyl-2-(4-methylphenyl)morpholine (PubChem CID 110369532) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is 4-(3-chloro-4-methoxyphenyl)sulfonyl-5-methyl-2-(4-methylphenyl)morpholine.
| Compound Name | 4-(3-chloro-4-methoxyphenyl)sulfonyl-5-methyl-2-(4-methylphenyl)morpholine |
|---|---|
| PubChem CID | 110369532 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 4-(3-chloro-4-methoxyphenyl)sulfonyl-5-methyl-2-(4-methylphenyl)morpholine |
| SMILES | COc1ccc(S(=O)(=O)N2CC(c3ccc(C)cc3)OCC2C)cc1Cl |
| InChI | InChI=1S/C19H22ClNO4S/c1-13-4-6-15(7-5-13)19-11-21(14(2)12-25-19)26(22,23)16-8-9-18(24-3)17(20)10-16/h4-10,14,19H,11-12H2,1-3H3 |
| InChIKey | OEJPXYZVXZPCND-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |