C17H17Cl2NO3S — CID 110369392
4-(3,4-dichlorophenyl)sulfonyl-5-methyl-2-phenylmorpholine (PubChem CID 110369392) has the molecular formula C17H17Cl2NO3S and a molecular weight of 386.30 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)sulfonyl-5-methyl-2-phenylmorpholine.
| Compound Name | 4-(3,4-dichlorophenyl)sulfonyl-5-methyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 110369392 |
| Molecular Formula | C17H17Cl2NO3S |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 4-(3,4-dichlorophenyl)sulfonyl-5-methyl-2-phenylmorpholine |
| SMILES | CC1COC(c2ccccc2)CN1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO3S/c1-12-11-23-17(13-5-3-2-4-6-13)10-20(12)24(21,22)14-7-8-15(18)16(19)9-14/h2-9,12,17H,10-11H2,1H3 |
| InChIKey | VVFWRQKTDPYVLD-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |