C21H27NO4S — CID 110369422
4-(4-ethoxy-2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine (PubChem CID 110369422) has the molecular formula C21H27NO4S and a molecular weight of 389.52 g/mol. Its IUPAC name is 4-(4-ethoxy-2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine.
| Compound Name | 4-(4-ethoxy-2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 110369422 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 4-(4-ethoxy-2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine |
| SMILES | CCOc1cc(C)c(S(=O)(=O)N2CC(c3ccccc3)OCC2C)cc1C |
| InChI | InChI=1S/C21H27NO4S/c1-5-25-19-11-16(3)21(12-15(19)2)27(23,24)22-13-20(26-14-17(22)4)18-9-7-6-8-10-18/h6-12,17,20H,5,13-14H2,1-4H3 |
| InChIKey | MMMCBAWUGXBKES-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |