C18H20FNO3S — CID 146099586
(2S,5R)-4-(5-fluoro-2-methylphenyl)sulfonyl-5-methyl-2-phenylmorpholine (PubChem CID 146099586) has the molecular formula C18H20FNO3S and a molecular weight of 349.43 g/mol. Its IUPAC name is (2S,5R)-4-(5-fluoro-2-methylphenyl)sulfonyl-5-methyl-2-phenylmorpholine.
| Compound Name | (2S,5R)-4-(5-fluoro-2-methylphenyl)sulfonyl-5-methyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 146099586 |
| Molecular Formula | C18H20FNO3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (2S,5R)-4-(5-fluoro-2-methylphenyl)sulfonyl-5-methyl-2-phenylmorpholine |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1C[C@H](c2ccccc2)OC[C@H]1C |
| InChI | InChI=1S/C18H20FNO3S/c1-13-8-9-16(19)10-18(13)24(21,22)20-11-17(23-12-14(20)2)15-6-4-3-5-7-15/h3-10,14,17H,11-12H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | APLSTFOENULCAO-RHSMWYFYSA-N |
| XLogP | 3.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |