C19H23NO3S — CID 110369387
4-(2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine (PubChem CID 110369387) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine.
| Compound Name | 4-(2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine |
|---|---|
| PubChem CID | 110369387 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-(2,5-dimethylphenyl)sulfonyl-5-methyl-2-phenylmorpholine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CC(c3ccccc3)OCC2C)c1 |
| InChI | InChI=1S/C19H23NO3S/c1-14-9-10-15(2)19(11-14)24(21,22)20-12-18(23-13-16(20)3)17-7-5-4-6-8-17/h4-11,16,18H,12-13H2,1-3H3 |
| InChIKey | LTRADVXLJSSRLV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |