C23H27NO5S — CID 10717477
(1R,2R,6S,7S)-6-(3,4-dimethoxyphenyl)-8-(4-methylphenyl)sulfonyl-10-oxa-8-azatricyclo[5.2.1.02,6]decane (PubChem CID 10717477) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is (1R,2R,6S,7S)-6-(3,4-dimethoxyphenyl)-8-(4-methylphenyl)sulfonyl-10-oxa-8-azatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2R,6S,7S)-6-(3,4-dimethoxyphenyl)-8-(4-methylphenyl)sulfonyl-10-oxa-8-azatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 10717477 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | (1R,2R,6S,7S)-6-(3,4-dimethoxyphenyl)-8-(4-methylphenyl)sulfonyl-10-oxa-8-azatricyclo[5.2.1.02,6]decane |
| SMILES | COc1ccc([C@]23CCC[C@H]2[C@@H]2CN(S(=O)(=O)c4ccc(C)cc4)[C@H]3O2)cc1OC |
| InChI | InChI=1S/C23H27NO5S/c1-15-6-9-17(10-7-15)30(25,26)24-14-21-18-5-4-12-23(18,22(24)29-21)16-8-11-19(27-2)20(13-16)28-3/h6-11,13,18,21-22H,4-5,12,14H2,1-3H3/t18-,21-,22-,23+/m0/s1 |
| InChIKey | LPEFDFXOPZQQAC-FDTGPBLFSA-N |
| XLogP | 3.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |