C31H31NO7S — CID 25105526
[(3S,5S,6S,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] acetate (PubChem CID 25105526) has the molecular formula C31H31NO7S and a molecular weight of 561.66 g/mol. Its IUPAC name is [(3S,5S,6S,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] acetate.
| Compound Name | [(3S,5S,6S,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] acetate |
|---|---|
| PubChem CID | 25105526 |
| Molecular Formula | C31H31NO7S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | [(3S,5S,6S,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2C(=C[C@@H]1OCc1ccccc1)[C@H](c1ccc3c(c1)OCO3)CN2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H31NO7S/c1-20-8-11-24(12-9-20)40(34,35)32-17-26(23-10-13-28-29(14-23)38-19-37-28)25-15-30(31(16-27(25)32)39-21(2)33)36-18-22-6-4-3-5-7-22/h3-15,26-27,30-31H,16-19H2,1-2H3/t26-,27-,30-,31-/m0/s1 |
| InChIKey | IJCYPPJNYJTZQD-FXZOGHEHSA-N |
| XLogP | 4.73 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|