C30H28F3NO8S2 — CID 25105481
[(3S,5S,6R,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] trifluoromethanesulfonate (PubChem CID 25105481) has the molecular formula C30H28F3NO8S2 and a molecular weight of 651.68 g/mol. Its IUPAC name is [(3S,5S,6R,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3S,5S,6R,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 25105481 |
| Molecular Formula | C30H28F3NO8S2 |
| Molecular Weight | 651.68 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | [(3S,5S,6R,7aS)-3-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-5-phenylmethoxy-2,3,5,6,7,7a-hexahydroindol-6-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H](c3ccc4c(c3)OCO4)C3=C[C@H](OCc4ccccc4)[C@H](OS(=O)(=O)C(F)(F)F)C[C@@H]32)cc1 |
| InChI | InChI=1S/C30H28F3NO8S2/c1-19-7-10-22(11-8-19)43(35,36)34-16-24(21-9-12-26-27(13-21)41-18-40-26)23-14-28(39-17-20-5-3-2-4-6-20)29(15-25(23)34)42-44(37,38)30(31,32)33/h2-14,24-25,28-29H,15-18H2,1H3/t24-,25-,28-,29+/m0/s1 |
| InChIKey | FYHADGALHMMMQG-YFVZOPNBSA-N |
| XLogP | 5.03 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.68 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|