C54H60O4Si2 — CID 101466919
2,7-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,6,8-tetrahydropyrene-2,7-dicarbaldehyde (PubChem CID 101466919) has the molecular formula C54H60O4Si2 and a molecular weight of 829.24 g/mol. Its IUPAC name is 2,7-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,6,8-tetrahydropyrene-2,7-dicarbaldehyde.
| Compound Name | 2,7-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,6,8-tetrahydropyrene-2,7-dicarbaldehyde |
|---|---|
| PubChem CID | 101466919 |
| Molecular Formula | C54H60O4Si2 |
| Molecular Weight | 829.24 g/mol |
| Exact Mass | 828.40 |
| IUPAC Name | 2,7-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,6,8-tetrahydropyrene-2,7-dicarbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2ccc(C3(C=O)Cc4ccc5c6c(ccc(c46)C3)CC(C=O)(c3ccc(-c4ccc(O[Si](C)(C)C(C)(C)C)cc4)cc3)C5)cc2)cc1 |
| InChI | InChI=1S/C54H60O4Si2/c1-51(2,3)59(7,8)57-47-27-19-39(20-28-47)37-15-23-45(24-16-37)53(35-55)31-41-11-13-43-33-54(36-56,34-44-14-12-42(32-53)49(41)50(43)44)46-25-17-38(18-26-46)40-21-29-48(30-22-40)58-60(9,10)52(4,5)6/h11-30,35-36H,31-34H2,1-10H3 |
| InChIKey | CCHAPJJFVFEJID-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.24 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|