C18H22BrFOSi — CID 15661507
[4-(3-bromo-5-fluorophenyl)phenoxy]-tert-butyl-dimethylsilane (PubChem CID 15661507) has the molecular formula C18H22BrFOSi and a molecular weight of 381.36 g/mol. Its IUPAC name is [4-(3-bromo-5-fluorophenyl)phenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [4-(3-bromo-5-fluorophenyl)phenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15661507 |
| Molecular Formula | C18H22BrFOSi |
| Molecular Weight | 381.36 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [4-(3-bromo-5-fluorophenyl)phenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2cc(F)cc(Br)c2)cc1 |
| InChI | InChI=1S/C18H22BrFOSi/c1-18(2,3)22(4,5)21-17-8-6-13(7-9-17)14-10-15(19)12-16(20)11-14/h6-12H,1-5H3 |
| InChIKey | LTCZFJXTYSRBRC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.36 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|