C26H37BrO3Si2 — CID 22221616
[4-[7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-2-yl]phenoxy]-tert-butyl-dimethylsilane (PubChem CID 22221616) has the molecular formula C26H37BrO3Si2 and a molecular weight of 533.66 g/mol. Its IUPAC name is [4-[7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-2-yl]phenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [4-[7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-2-yl]phenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 22221616 |
| Molecular Formula | C26H37BrO3Si2 |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | [4-[7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-1-benzofuran-2-yl]phenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2cc3cc(O[Si](C)(C)C(C)(C)C)cc(Br)c3o2)cc1 |
| InChI | InChI=1S/C26H37BrO3Si2/c1-25(2,3)31(7,8)29-20-13-11-18(12-14-20)23-16-19-15-21(17-22(27)24(19)28-23)30-32(9,10)26(4,5)6/h11-17H,1-10H3 |
| InChIKey | PWMAKBFTKBCJSN-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|