C19H34OSi — CID 10040842
[(4aS,6S)-1,4a-dimethyl-3,4,5,6,7,8-hexahydrobenzo[7]annulen-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10040842) has the molecular formula C19H34OSi and a molecular weight of 306.57 g/mol. Its IUPAC name is [(4aS,6S)-1,4a-dimethyl-3,4,5,6,7,8-hexahydrobenzo[7]annulen-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aS,6S)-1,4a-dimethyl-3,4,5,6,7,8-hexahydrobenzo[7]annulen-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10040842 |
| Molecular Formula | C19H34OSi |
| Molecular Weight | 306.57 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | [(4aS,6S)-1,4a-dimethyl-3,4,5,6,7,8-hexahydrobenzo[7]annulen-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=CCC[C@@]2(C)C[C@@H](O[Si](C)(C)C(C)(C)C)CCC=C12 |
| InChI | InChI=1S/C19H34OSi/c1-15-10-9-13-19(5)14-16(11-8-12-17(15)19)20-21(6,7)18(2,3)4/h10,12,16H,8-9,11,13-14H2,1-7H3/t16-,19-/m0/s1 |
| InChIKey | RWGOTIHZTBJILN-LPHOPBHVSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|