C20H32N2O2Si — CID 160886295
5-[tert-butyl(dimethyl)silyl]oxycyclohexene-1-carbonitrile;5-hydroxycyclohexene-1-carbonitrile (PubChem CID 160886295) has the molecular formula C20H32N2O2Si and a molecular weight of 360.57 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxycyclohexene-1-carbonitrile;5-hydroxycyclohexene-1-carbonitrile.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxycyclohexene-1-carbonitrile;5-hydroxycyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 160886295 |
| Molecular Formula | C20H32N2O2Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxycyclohexene-1-carbonitrile;5-hydroxycyclohexene-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC=C(C#N)C1.N#CC1=CCCC(O)C1 |
| InChI | InChI=1S/C13H23NOSi.C7H9NO/c1-13(2,3)16(4,5)15-12-8-6-7-11(9-12)10-14;8-5-6-2-1-3-7(9)4-6/h7,12H,6,8-9H2,1-5H3;2,7,9H,1,3-4H2 |
| InChIKey | SNRHJQWSGGEUOH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|