C11H19NOSi — CID 102012979
4-[tert-butyl(dimethyl)silyl]oxycyclobutene-1-carbonitrile (PubChem CID 102012979) has the molecular formula C11H19NOSi and a molecular weight of 209.36 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxycyclobutene-1-carbonitrile.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxycyclobutene-1-carbonitrile |
|---|---|
| PubChem CID | 102012979 |
| Molecular Formula | C11H19NOSi |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxycyclobutene-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC=C1C#N |
| InChI | InChI=1S/C11H19NOSi/c1-11(2,3)14(4,5)13-10-7-6-9(10)8-12/h6,10H,7H2,1-5H3 |
| InChIKey | LTDYOWQARGAXGH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|