C14H25NO2Si — CID 11277160
(3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopentene-1-carbonitrile (PubChem CID 11277160) has the molecular formula C14H25NO2Si and a molecular weight of 267.44 g/mol. Its IUPAC name is (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopentene-1-carbonitrile.
| Compound Name | (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopentene-1-carbonitrile |
|---|---|
| PubChem CID | 11277160 |
| Molecular Formula | C14H25NO2Si |
| Molecular Weight | 267.44 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (3S,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopentene-1-carbonitrile |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)C=C(C#N)[C@@H]1O |
| InChI | InChI=1S/C14H25NO2Si/c1-13(2,3)18(6,7)17-11-8-10(9-15)12(16)14(11,4)5/h8,11-12,16H,1-7H3/t11-,12-/m0/s1 |
| InChIKey | FOLHFKSJEURYLF-RYUDHWBXSA-N |
| XLogP | 3.23 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|