C16H30O3Si — CID 101066730
1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopenten-1-yl]propan-1-one (PubChem CID 101066730) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopenten-1-yl]propan-1-one.
| Compound Name | 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopenten-1-yl]propan-1-one |
|---|---|
| PubChem CID | 101066730 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 1-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,4-dimethylcyclopenten-1-yl]propan-1-one |
| SMILES | CCC(=O)C1=C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H]1O |
| InChI | InChI=1S/C16H30O3Si/c1-9-12(17)11-10-13(16(5,6)14(11)18)19-20(7,8)15(2,3)4/h10,13-14,18H,9H2,1-8H3/t13-,14-/m0/s1 |
| InChIKey | PHXFSVHQSMZAHO-KBPBESRZSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|