C17H34OSi — CID 132558837
tert-butyl-dimethyl-[[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methoxy]silane (PubChem CID 132558837) has the molecular formula C17H34OSi and a molecular weight of 282.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methoxy]silane |
|---|---|
| PubChem CID | 132558837 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,5R)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]methoxy]silane |
| SMILES | CC1=CC[C@@H](C)C(C)(C)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34OSi/c1-13-10-11-14(2)17(6,7)15(13)12-18-19(8,9)16(3,4)5/h10,14-15H,11-12H2,1-9H3/t14-,15-/m1/s1 |
| InChIKey | JOVCWWAPMJZSEU-HUUCEWRRSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|