C17H32O2Si — CID 11426464
(1R,2R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one (PubChem CID 11426464) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (1R,2R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one.
| Compound Name | (1R,2R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one |
|---|---|
| PubChem CID | 11426464 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (1R,2R,4R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,7,7-trimethylbicyclo[4.1.0]heptan-3-one |
| SMILES | C[C@@H]1C[C@@H]2[C@H]([C@H](CO[Si](C)(C)C(C)(C)C)C1=O)C2(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-11-9-13-14(17(13,5)6)12(15(11)18)10-19-20(7,8)16(2,3)4/h11-14H,9-10H2,1-8H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | WKPMSLUHTDRPPC-RQJABVFESA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|