C27H50O2Si2 — CID 11026965
[(1aR,4S,7aS,7bR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,1,7-trimethyl-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11026965) has the molecular formula C27H50O2Si2 and a molecular weight of 462.87 g/mol. Its IUPAC name is [(1aR,4S,7aS,7bR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,1,7-trimethyl-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1aR,4S,7aS,7bR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,1,7-trimethyl-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11026965 |
| Molecular Formula | C27H50O2Si2 |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | [(1aR,4S,7aS,7bR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,1,7-trimethyl-1a,2,3,4,7a,7b-hexahydrocyclopropa[e]azulen-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=C(O[Si](C)(C)C(C)(C)C)C=C2[C@@H](CO[Si](C)(C)C(C)(C)C)CC[C@@H]3[C@H]([C@@H]21)C3(C)C |
| InChI | InChI=1S/C27H50O2Si2/c1-18-22(29-31(12,13)26(5,6)7)16-20-19(17-28-30(10,11)25(2,3)4)14-15-21-24(23(18)20)27(21,8)9/h16,19,21,23-24H,14-15,17H2,1-13H3/t19-,21-,23-,24-/m1/s1 |
| InChIKey | UOXJUDIOWGAULG-WDWDUUAGSA-N |
| XLogP | 8.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|