C18H34INO2Si2 — CID 10961835
(1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-ene-1-carbonitrile (PubChem CID 10961835) has the molecular formula C18H34INO2Si2 and a molecular weight of 479.55 g/mol. Its IUPAC name is (1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-ene-1-carbonitrile.
| Compound Name | (1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-ene-1-carbonitrile |
|---|---|
| PubChem CID | 10961835 |
| Molecular Formula | C18H34INO2Si2 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (1S,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-iodocyclopent-2-ene-1-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C=C(I)[C@](C#N)(O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H34INO2Si2/c1-16(2,3)23(7,8)21-14-11-15(19)18(12-14,13-20)22-24(9,10)17(4,5)6/h11,14H,12H2,1-10H3/t14-,18+/m1/s1 |
| InChIKey | BTSQSGILEOYEKU-KDOFPFPSSA-N |
| XLogP | 6.38 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|