C22H37NO4Si — CID 71613479
(1S,3S,4aS,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2-hydroxypropan-2-yl)spiro[1,2,3,4,8,8a-hexahydronaphthalene-7,2'-1,3-dioxolane]-4a-carbonitrile (PubChem CID 71613479) has the molecular formula C22H37NO4Si and a molecular weight of 407.63 g/mol. Its IUPAC name is (1S,3S,4aS,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2-hydroxypropan-2-yl)spiro[1,2,3,4,8,8a-hexahydronaphthalene-7,2'-1,3-dioxolane]-4a-carbonitrile.
| Compound Name | (1S,3S,4aS,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2-hydroxypropan-2-yl)spiro[1,2,3,4,8,8a-hexahydronaphthalene-7,2'-1,3-dioxolane]-4a-carbonitrile |
|---|---|
| PubChem CID | 71613479 |
| Molecular Formula | C22H37NO4Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | (1S,3S,4aS,8aS)-1-[tert-butyl(dimethyl)silyl]oxy-3-(2-hydroxypropan-2-yl)spiro[1,2,3,4,8,8a-hexahydronaphthalene-7,2'-1,3-dioxolane]-4a-carbonitrile |
| SMILES | CC(C)(O)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2CC3(C=C[C@@]2(C#N)C1)OCCO3 |
| InChI | InChI=1S/C22H37NO4Si/c1-19(2,3)28(6,7)27-18-12-16(20(4,5)24)13-21(15-23)8-9-22(14-17(18)21)25-10-11-26-22/h8-9,16-18,24H,10-14H2,1-7H3/t16-,17-,18+,21+/m1/s1 |
| InChIKey | FTXNVGILTAJMHR-WIRSXHRWSA-N |
| XLogP | 4.39 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|