C21H39NO5Si2 — CID 11744036
[(2R,3S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyano-7-oxabicyclo[4.1.0]heptan-3-yl] acetate (PubChem CID 11744036) has the molecular formula C21H39NO5Si2 and a molecular weight of 441.72 g/mol. Its IUPAC name is [(2R,3S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyano-7-oxabicyclo[4.1.0]heptan-3-yl] acetate.
| Compound Name | [(2R,3S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyano-7-oxabicyclo[4.1.0]heptan-3-yl] acetate |
|---|---|
| PubChem CID | 11744036 |
| Molecular Formula | C21H39NO5Si2 |
| Molecular Weight | 441.72 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | [(2R,3S,5R)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-cyano-7-oxabicyclo[4.1.0]heptan-3-yl] acetate |
| SMILES | CC(=O)O[C@]1(C#N)C[C@@H](O[Si](C)(C)C(C)(C)C)C2OC2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39NO5Si2/c1-14(23)25-21(13-22)12-15(26-28(8,9)19(2,3)4)16-17(24-16)18(21)27-29(10,11)20(5,6)7/h15-18H,12H2,1-11H3/t15-,16?,17?,18-,21+/m1/s1 |
| InChIKey | VYXXLZCCAKRNKW-PERYLBAUSA-N |
| XLogP | 4.76 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.72 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|