C23H48O3Si2 — CID 90770166
trans-(3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1-(oxan-2-yloxy)cyclohexan-1-ol (PubChem CID 90770166) has the molecular formula C23H48O3Si2 and a molecular weight of 428.81 g/mol. Its IUPAC name is trans-(3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1-(oxan-2-yloxy)cyclohexan-1-ol.
| Compound Name | trans-(3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1-(oxan-2-yloxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 90770166 |
| Molecular Formula | C23H48O3Si2 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | trans-(3R,5R)-3,5-bis[tert-butyl(dimethyl)silyl]-1-(oxan-2-yloxy)cyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)[C@H]1C[C@H]([Si](C)(C)C(C)(C)C)CC(O)(OC2CCCCO2)C1 |
| InChI | InChI=1S/C23H48O3Si2/c1-21(2,3)27(7,8)18-15-19(28(9,10)22(4,5)6)17-23(24,16-18)26-20-13-11-12-14-25-20/h18-20,24H,11-17H2,1-10H3/t18-,19-,20?/m0/s1 |
| InChIKey | FFRWCDXNZIZFGF-NFBCFJMWSA-N |
| XLogP | 7.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|