C14H24O4 — CID 173476655
(2,6-dimethylcyclohexyl) oxan-2-yl carbonate (PubChem CID 173476655) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2,6-dimethylcyclohexyl) oxan-2-yl carbonate.
| Compound Name | (2,6-dimethylcyclohexyl) oxan-2-yl carbonate |
|---|---|
| PubChem CID | 173476655 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (2,6-dimethylcyclohexyl) oxan-2-yl carbonate |
| SMILES | CC1CCCC(C)C1OC(=O)OC1CCCCO1 |
| InChI | InChI=1S/C14H24O4/c1-10-6-5-7-11(2)13(10)18-14(15)17-12-8-3-4-9-16-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | GQCJQXARHHPILQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |