C12H28Si — CID 140729295
ditert-butyl-methyl-propan-2-ylsilane (PubChem CID 140729295) has the molecular formula C12H28Si and a molecular weight of 200.44 g/mol. Its IUPAC name is ditert-butyl-methyl-propan-2-ylsilane.
| Compound Name | ditert-butyl-methyl-propan-2-ylsilane |
|---|---|
| PubChem CID | 140729295 |
| Molecular Formula | C12H28Si |
| Molecular Weight | 200.44 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | ditert-butyl-methyl-propan-2-ylsilane |
| SMILES | CC(C)[Si](C)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H28Si/c1-10(2)13(9,11(3,4)5)12(6,7)8/h10H,1-9H3 |
| InChIKey | ZMYDZRZWUYICMJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|