C17H44Si2 — CID 160827428
tert-butyl(trimethyl)silane;2,3-dimethylbutan-2-yl(trimethyl)silane;methane (PubChem CID 160827428) has the molecular formula C17H44Si2 and a molecular weight of 304.71 g/mol. Its IUPAC name is tert-butyl(trimethyl)silane;2,3-dimethylbutan-2-yl(trimethyl)silane;methane.
| Compound Name | tert-butyl(trimethyl)silane;2,3-dimethylbutan-2-yl(trimethyl)silane;methane |
|---|---|
| PubChem CID | 160827428 |
| Molecular Formula | C17H44Si2 |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.30 |
| IUPAC Name | tert-butyl(trimethyl)silane;2,3-dimethylbutan-2-yl(trimethyl)silane;methane |
| SMILES | C.CC(C)(C)[Si](C)(C)C.CC(C)C(C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C9H22Si.C7H18Si.CH4/c1-8(2)9(3,4)10(5,6)7;1-7(2,3)8(4,5)6;/h8H,1-7H3;1-6H3;1H4 |
| InChIKey | SGJDKLUMGXUYKF-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|