About (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine
(E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine (PubChem CID 134925367) has the molecular formula C12H27NSi
and a molecular weight of 213.44 g/mol. Its IUPAC name is (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine.
Molecular Properties
| Compound Name | (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine |
| PubChem CID | 134925367 |
| Molecular Formula | C12H27NSi |
| Molecular Weight | 213.44 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine |
| SMILES | CCC/C=N/[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C12H27NSi/c1-8-9-10-13-14(6,7)12(4,5)11(2)3/h10-11H,8-9H2,1-7H3/b13-10+ |
| InChIKey | AZIARFUCQNOQJU-JLHYYAGUSA-N |
| XLogP | 4.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine?
The IUPAC name of (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine (CID 134925367) is (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine.
What is the SMILES notation for (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine?
The canonical SMILES for (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine is CCC/C=N/[Si](C)(C)C(C)(C)C(C)C.
What is the InChIKey of (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine?
The InChIKey is AZIARFUCQNOQJU-JLHYYAGUSA-N. The full InChI is InChI=1S/C12H27NSi/c1-8-9-10-13-14(6,7)12(4,5)11(2)3/h10-11H,8-9H2,1-7H3/b13-10+.
What are the key properties of (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine?
(E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine has a molecular weight of 213.44 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine is sourced from PubChem (CID 134925367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).