C12H27NSi — CID 134925367
(E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine (PubChem CID 134925367) has the molecular formula C12H27NSi and a molecular weight of 213.44 g/mol. Its IUPAC name is (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine.
| Compound Name | (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine |
|---|---|
| PubChem CID | 134925367 |
| Molecular Formula | C12H27NSi |
| Molecular Weight | 213.44 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | (E)-N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]butan-1-imine |
| SMILES | CCC/C=N/[Si](C)(C)C(C)(C)C(C)C |
| InChI | InChI=1S/C12H27NSi/c1-8-9-10-13-14(6,7)12(4,5)11(2)3/h10-11H,8-9H2,1-7H3/b13-10+ |
| InChIKey | AZIARFUCQNOQJU-JLHYYAGUSA-N |
| XLogP | 4.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|