C12H29NO2Si — CID 139658454
N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-methylpropan-1-amine (PubChem CID 139658454) has the molecular formula C12H29NO2Si and a molecular weight of 247.45 g/mol. Its IUPAC name is N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-methylpropan-1-amine.
| Compound Name | N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 139658454 |
| Molecular Formula | C12H29NO2Si |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N-[2,3-dimethylbutan-2-yl(dimethoxy)silyl]-N-methylpropan-1-amine |
| SMILES | CCCN(C)[Si](OC)(OC)C(C)(C)C(C)C |
| InChI | InChI=1S/C12H29NO2Si/c1-9-10-13(6)16(14-7,15-8)12(4,5)11(2)3/h11H,9-10H2,1-8H3 |
| InChIKey | JPVOTUOJKNOBDQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|